Organic acids and derivatives
Filtered Search Results
Thermo Scientific Chemicals Butyl p-toluenesulfonate, 99%
CAS: 778-28-9 Molecular Formula: C11H16O3S Molecular Weight (g/mol): 228.31 MDL Number: MFCD00027203 InChI Key: QYJXDIUNDMRLAO-UHFFFAOYSA-N Synonym: butyl p-toluenesulfonate,butyl tosylate,n-butyl p-toluenesulfonate,butyl p-methylbenzenesulfonate,butyl-p-toluenesulfonate,p-toluenesulfonic acid, butyl ester,benzenesulfonic acid, 4-methyl-, butyl ester,butyl toluene-4-sulphonate,p-toluenesulfonic acid n-butyl ester,p-toluene sulfonic acid, butyl ester PubChem CID: 13066 IUPAC Name: butyl 4-methylbenzenesulfonate SMILES: CCCCOS(=O)(=O)C1=CC=C(C)C=C1
| PubChem CID | 13066 |
|---|---|
| CAS | 778-28-9 |
| Molecular Weight (g/mol) | 228.31 |
| MDL Number | MFCD00027203 |
| SMILES | CCCCOS(=O)(=O)C1=CC=C(C)C=C1 |
| Synonym | butyl p-toluenesulfonate,butyl tosylate,n-butyl p-toluenesulfonate,butyl p-methylbenzenesulfonate,butyl-p-toluenesulfonate,p-toluenesulfonic acid, butyl ester,benzenesulfonic acid, 4-methyl-, butyl ester,butyl toluene-4-sulphonate,p-toluenesulfonic acid n-butyl ester,p-toluene sulfonic acid, butyl ester |
| IUPAC Name | butyl 4-methylbenzenesulfonate |
| InChI Key | QYJXDIUNDMRLAO-UHFFFAOYSA-N |
| Molecular Formula | C11H16O3S |
Thermo Scientific Chemicals Potassium sodium tartrate tetrahydrate, 99+%, for analysis
CAS: 6381-59-5 MDL Number: MFCD00150989 InChI Key: VZOPRCCTKLAGPN-UHFFFAOYSA-L Synonym: potassium sodium tartrate tetrahydrate,sodium potassium tartrate tetrahydrate,monopotassium monosodium tartrate tetrahydrate,sodiumpotassiumtartrate,tetr,potassium sodium 2,3-dihydroxybutanedioate tetrahydrate,potassium sodium tetrahydrate tartrate,l +-tartaric acid potassium sodium salt,acmc-209nif,acmc-20aju8,ksc493o7j PubChem CID: 2724148 IUPAC Name: potassium;sodium;2,3-dihydroxybutanedioate;tetrahydrate SMILES: C(C(C(=O)[O-])O)(C(=O)[O-])O.O.O.O.O.[Na+].[K+]
| PubChem CID | 2724148 |
|---|---|
| CAS | 6381-59-5 |
| MDL Number | MFCD00150989 |
| SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.O.O.O.O.[Na+].[K+] |
| Synonym | potassium sodium tartrate tetrahydrate,sodium potassium tartrate tetrahydrate,monopotassium monosodium tartrate tetrahydrate,sodiumpotassiumtartrate,tetr,potassium sodium 2,3-dihydroxybutanedioate tetrahydrate,potassium sodium tetrahydrate tartrate,l +-tartaric acid potassium sodium salt,acmc-209nif,acmc-20aju8,ksc493o7j |
| IUPAC Name | potassium;sodium;2,3-dihydroxybutanedioate;tetrahydrate |
| InChI Key | VZOPRCCTKLAGPN-UHFFFAOYSA-L |
Thermo Scientific Chemicals Triethyl citrate, 99%
CAS: 77-93-0 Molecular Formula: C12H20O7 Molecular Weight (g/mol): 276.29 InChI Key: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC Name: triethyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| CAS | 77-93-0 |
| Molecular Weight (g/mol) | 276.29 |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molecular Formula | C12H20O7 |
Thermo Scientific Chemicals Tetraacetylethylenediamine, 90%
CAS: 10543-57-4 Molecular Formula: C10H16N2O4 Molecular Weight (g/mol): 228.25 MDL Number: MFCD00014967 InChI Key: BGRWYDHXPHLNKA-UHFFFAOYSA-N Synonym: tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide PubChem CID: 66347 IUPAC Name: N-acetyl-N-[2-(diacetylamino)ethyl]acetamide SMILES: CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C
| PubChem CID | 66347 |
|---|---|
| CAS | 10543-57-4 |
| Molecular Weight (g/mol) | 228.25 |
| MDL Number | MFCD00014967 |
| SMILES | CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C |
| Synonym | tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide |
| IUPAC Name | N-acetyl-N-[2-(diacetylamino)ethyl]acetamide |
| InChI Key | BGRWYDHXPHLNKA-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O4 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99.5%, ACS reagent
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Thermo Scientific Chemicals Trimethylsilyl trifluoromethanesulfonate, 99%
CAS: 27607-77-8 Molecular Formula: C4H9F3O3SSi Molecular Weight (g/mol): 222.253 MDL Number: MFCD00000406 InChI Key: FTVLMFQEYACZNP-UHFFFAOYSA-N Synonym: trimethylsilyl triflate,tmsotf,trifluoromethanesulfonic acid trimethylsilyl ester,trimethylsilyl trifluoromethylsulphonate,unii-z84v0cbh9j,methanesulfonic acid, trifluoro-, trimethylsilyl ester,trimethylsilyl trifluoromethylsulfonate,trimethylsllytrifluoromethanesulphonate,trimethylsilyl trifluoromethanesulphonate,trimethylsilyltrifluoromethanesulphonate PubChem CID: 65367 IUPAC Name: trimethylsilyl trifluoromethanesulfonate SMILES: C[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 65367 |
|---|---|
| CAS | 27607-77-8 |
| Molecular Weight (g/mol) | 222.253 |
| MDL Number | MFCD00000406 |
| SMILES | C[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | trimethylsilyl triflate,tmsotf,trifluoromethanesulfonic acid trimethylsilyl ester,trimethylsilyl trifluoromethylsulphonate,unii-z84v0cbh9j,methanesulfonic acid, trifluoro-, trimethylsilyl ester,trimethylsilyl trifluoromethylsulfonate,trimethylsllytrifluoromethanesulphonate,trimethylsilyl trifluoromethanesulphonate,trimethylsilyltrifluoromethanesulphonate |
| IUPAC Name | trimethylsilyl trifluoromethanesulfonate |
| InChI Key | FTVLMFQEYACZNP-UHFFFAOYSA-N |
| Molecular Formula | C4H9F3O3SSi |
MP Biomedicals, Inc Ferric ammonium citrate, MP Biomedicals™
CAS: 1185-57-5 Molecular Formula: C6H11FeNO7+3 Molecular Weight (g/mol): 264.999 InChI Key: FRHBOQMZUOWXQL-UHFFFAOYSA-N Synonym: ammonium ferric citrate,ferri seltz,ammonii ferri citras,ferric ammonium citrate,iron ammonium citrate,ammonium iron 3+ citrate,ammonium iron iii citrate,iron ammonium citrate, green,ferri-ammoniumcitrat, braunes,ferriseltz PubChem CID: 118984355 IUPAC Name: azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Fe+3]
| PubChem CID | 118984355 |
|---|---|
| CAS | 1185-57-5 |
| Molecular Weight (g/mol) | 264.999 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Fe+3] |
| Synonym | ammonium ferric citrate,ferri seltz,ammonii ferri citras,ferric ammonium citrate,iron ammonium citrate,ammonium iron 3+ citrate,ammonium iron iii citrate,iron ammonium citrate, green,ferri-ammoniumcitrat, braunes,ferriseltz |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) |
| InChI Key | FRHBOQMZUOWXQL-UHFFFAOYSA-N |
| Molecular Formula | C6H11FeNO7+3 |
Thermo Scientific Chemicals L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Thermo Scientific Chemicals Vinyl acetate, 99%, stab. with 8-12ppm hydroquinone
CAS: 108-05-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00008713 InChI Key: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC Name: ethenyl acetate SMILES: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| CAS | 108-05-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:46916 |
| MDL Number | MFCD00008713 |
| SMILES | CC(=O)OC=C |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| IUPAC Name | ethenyl acetate |
| InChI Key | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Thermo Scientific Chemicals 2-Hydroxyethyl methacrylate, 97%, stabilized
CAS: 868-77-9 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00002863 InChI Key: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC Name: 2-hydroxyethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCO
| PubChem CID | 13360 |
|---|---|
| CAS | 868-77-9 |
| Molecular Weight (g/mol) | 130.14 |
| ChEBI | CHEBI:34288 |
| MDL Number | MFCD00002863 |
| SMILES | CC(=C)C(=O)OCCO |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate |
| InChI Key | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
Thermo Scientific Chemicals Phthalimide, 99%
CAS: 85-41-6 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 MDL Number: MFCD00005881 InChI Key: XKJCHHZQLQNZHY-UHFFFAOYSA-N Synonym: phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid PubChem CID: 6809 ChEBI: CHEBI:38817 IUPAC Name: isoindole-1,3-dione SMILES: O=C1NC(=O)C2=CC=CC=C12
| PubChem CID | 6809 |
|---|---|
| CAS | 85-41-6 |
| Molecular Weight (g/mol) | 147.13 |
| ChEBI | CHEBI:38817 |
| MDL Number | MFCD00005881 |
| SMILES | O=C1NC(=O)C2=CC=CC=C12 |
| Synonym | phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid |
| IUPAC Name | isoindole-1,3-dione |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
Thermo Scientific Chemicals n-Butyl acetate, 99+%, extra pure
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Thermo Scientific Chemicals Sodium 3-hydroxybutyrate, 98%
CAS: 150-83-4 Molecular Formula: C4H7NaO3 Molecular Weight (g/mol): 126.087 MDL Number: MFCD00016716 InChI Key: NBPUSGBJDWCHKC-UHFFFAOYSA-M Synonym: sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt PubChem CID: 23676771 IUPAC Name: sodium;3-hydroxybutanoate SMILES: CC(CC(=O)[O-])O.[Na+]
| PubChem CID | 23676771 |
|---|---|
| CAS | 150-83-4 |
| Molecular Weight (g/mol) | 126.087 |
| MDL Number | MFCD00016716 |
| SMILES | CC(CC(=O)[O-])O.[Na+] |
| Synonym | sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt |
| IUPAC Name | sodium;3-hydroxybutanoate |
| InChI Key | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO3 |
Thermo Scientific Chemicals Sodium succinate hexahydrate, 99%
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Thermo Scientific Chemicals Ethylene glycol dimethacrylate, 98%, stab. with 100ppm 4-methoxyphenol
CAS: 97-90-5 Molecular Formula: C10H14O4 Molecular Weight (g/mol): 198.22 MDL Number: MFCD00008590 InChI Key: STVZJERGLQHEKB-UHFFFAOYSA-N Synonym: ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate PubChem CID: 7355 ChEBI: CHEBI:53436 IUPAC Name: 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCOC(=O)C(C)=C
| PubChem CID | 7355 |
|---|---|
| CAS | 97-90-5 |
| Molecular Weight (g/mol) | 198.22 |
| ChEBI | CHEBI:53436 |
| MDL Number | MFCD00008590 |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| Synonym | ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| InChI Key | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Molecular Formula | C10H14O4 |